C13H13NO7 — CID 10589942
(2R,3R,4S,5R,6S)-2-ethynyl-6-(4-nitrophenoxy)oxane-3,4,5-triol (PubChem CID 10589942) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-ethynyl-6-(4-nitrophenoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-ethynyl-6-(4-nitrophenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10589942 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-ethynyl-6-(4-nitrophenoxy)oxane-3,4,5-triol |
| SMILES | C#C[C@H]1O[C@@H](Oc2ccc([N+](=O)[O-])cc2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H13NO7/c1-2-9-10(15)11(16)12(17)13(21-9)20-8-5-3-7(4-6-8)14(18)19/h1,3-6,9-13,15-17H/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | SKJGMOWITQNRDD-KSSYENDESA-N |
| XLogP | -0.59 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|