C14H22N2O5 — CID 10590183
tert-butyl (3aS,6S,6aS)-6-(cyanomethyl)-4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 10590183) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is tert-butyl (3aS,6S,6aS)-6-(cyanomethyl)-4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,6S,6aS)-6-(cyanomethyl)-4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 10590183 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | tert-butyl (3aS,6S,6aS)-6-(cyanomethyl)-4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(O)[C@H]2OC(C)(C)O[C@H]2[C@@H]1CC#N |
| InChI | InChI=1S/C14H22N2O5/c1-13(2,3)21-12(18)16-8(6-7-15)9-10(11(16)17)20-14(4,5)19-9/h8-11,17H,6H2,1-5H3/t8-,9-,10-,11?/m0/s1 |
| InChIKey | FCXLTWPGHQZVGN-KXBCIPKXSA-N |
| XLogP | 1.36 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |