C17H36O2Si — CID 10590376
hydroxy-dimethyl-[(1S)-1-[(4S)-non-1-en-4-yl]oxyhexyl]silane (PubChem CID 10590376) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is hydroxy-dimethyl-[(1S)-1-[(4S)-non-1-en-4-yl]oxyhexyl]silane.
| Compound Name | hydroxy-dimethyl-[(1S)-1-[(4S)-non-1-en-4-yl]oxyhexyl]silane |
|---|---|
| PubChem CID | 10590376 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | hydroxy-dimethyl-[(1S)-1-[(4S)-non-1-en-4-yl]oxyhexyl]silane |
| SMILES | C=CC[C@H](CCCCC)O[C@H](CCCCC)[Si](C)(C)O |
| InChI | InChI=1S/C17H36O2Si/c1-6-9-11-14-16(13-8-3)19-17(20(4,5)18)15-12-10-7-2/h8,16-18H,3,6-7,9-15H2,1-2,4-5H3/t16-,17+/m1/s1 |
| InChIKey | IAOASHBKEPJBPH-SJORKVTESA-N |
| XLogP | 5.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|