C18H24O4 — CID 10590620
methyl (1R,6S)-3-methyl-1-[(E)-4-methyl-5-oxopent-3-enyl]-2-oxo-6-prop-1-en-2-ylcyclohex-3-ene-1-carboxylate (PubChem CID 10590620) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl (1R,6S)-3-methyl-1-[(E)-4-methyl-5-oxopent-3-enyl]-2-oxo-6-prop-1-en-2-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,6S)-3-methyl-1-[(E)-4-methyl-5-oxopent-3-enyl]-2-oxo-6-prop-1-en-2-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10590620 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | methyl (1R,6S)-3-methyl-1-[(E)-4-methyl-5-oxopent-3-enyl]-2-oxo-6-prop-1-en-2-ylcyclohex-3-ene-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CC=C(C)C(=O)[C@]1(CC/C=C(\C)C=O)C(=O)OC |
| InChI | InChI=1S/C18H24O4/c1-12(2)15-9-8-14(4)16(20)18(15,17(21)22-5)10-6-7-13(3)11-19/h7-8,11,15H,1,6,9-10H2,2-5H3/b13-7+/t15-,18+/m0/s1 |
| InChIKey | UQNRQGXVVGDMIB-OOXPDHLJSA-N |
| XLogP | 3.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|