C17H23NO4 — CID 10590691
(E,4S,5S)-5-methyl-4-[methyl(phenylmethoxycarbonyl)amino]hept-2-enoic acid (PubChem CID 10590691) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (E,4S,5S)-5-methyl-4-[methyl(phenylmethoxycarbonyl)amino]hept-2-enoic acid.
| Compound Name | (E,4S,5S)-5-methyl-4-[methyl(phenylmethoxycarbonyl)amino]hept-2-enoic acid |
|---|---|
| PubChem CID | 10590691 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (E,4S,5S)-5-methyl-4-[methyl(phenylmethoxycarbonyl)amino]hept-2-enoic acid |
| SMILES | CC[C@H](C)[C@@H](/C=C/C(=O)O)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-4-13(2)15(10-11-16(19)20)18(3)17(21)22-12-14-8-6-5-7-9-14/h5-11,13,15H,4,12H2,1-3H3,(H,19,20)/b11-10+/t13-,15+/m0/s1 |
| InChIKey | INAWHECGYWWVAM-VLMQMFMZSA-N |
| XLogP | 3.31 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|