C15H20INO4 — CID 173256765
benzyl N-(iodomethoxy)-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 173256765) has the molecular formula C15H20INO4 and a molecular weight of 405.23 g/mol. Its IUPAC name is benzyl N-(iodomethoxy)-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-(iodomethoxy)-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 173256765 |
| Molecular Formula | C15H20INO4 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | benzyl N-(iodomethoxy)-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@@H](C=O)N(OCI)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20INO4/c1-3-12(2)14(9-18)17(21-11-16)15(19)20-10-13-7-5-4-6-8-13/h4-9,12,14H,3,10-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | MQYDQEGQQHQXRB-GXTWGEPZSA-N |
| XLogP | 3.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|