C21H16N2O — CID 10591205
(16S,18R)-2,5-diazaheptacyclo[12.9.0.03,12.04,9.015,19.016,23.018,22]tricosa-1(14),2,4(9),5,7,10,12-heptaen-21-one (PubChem CID 10591205) has the molecular formula C21H16N2O and a molecular weight of 312.37 g/mol. Its IUPAC name is (16S,18R)-2,5-diazaheptacyclo[12.9.0.03,12.04,9.015,19.016,23.018,22]tricosa-1(14),2,4(9),5,7,10,12-heptaen-21-one.
| Compound Name | (16S,18R)-2,5-diazaheptacyclo[12.9.0.03,12.04,9.015,19.016,23.018,22]tricosa-1(14),2,4(9),5,7,10,12-heptaen-21-one |
|---|---|
| PubChem CID | 10591205 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (16S,18R)-2,5-diazaheptacyclo[12.9.0.03,12.04,9.015,19.016,23.018,22]tricosa-1(14),2,4(9),5,7,10,12-heptaen-21-one |
| SMILES | O=C1CC2C3c4cc5ccc6cccnc6c5nc4C4C1[C@@H]2C[C@@H]34 |
| InChI | InChI=1S/C21H16N2O/c24-15-8-12-11-7-13-16(12)14-6-10-4-3-9-2-1-5-22-19(9)20(10)23-21(14)18(13)17(11)15/h1-6,11-13,16-18H,7-8H2/t11-,12?,13+,16?,17?,18?/m1/s1 |
| InChIKey | CRQNOKNZFRSJEN-NHEHHNMDSA-N |
| XLogP | 3.82 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|