C20H16N4 — CID 10591208
4-phenyl-6-[(E)-2-phenylethenyl]-2H-pyrazolo[3,4-b]pyridin-3-amine (PubChem CID 10591208) has the molecular formula C20H16N4 and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-phenyl-6-[(E)-2-phenylethenyl]-2H-pyrazolo[3,4-b]pyridin-3-amine.
| Compound Name | 4-phenyl-6-[(E)-2-phenylethenyl]-2H-pyrazolo[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 10591208 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-phenyl-6-[(E)-2-phenylethenyl]-2H-pyrazolo[3,4-b]pyridin-3-amine |
| SMILES | Nc1[nH]nc2nc(/C=C/c3ccccc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H16N4/c21-19-18-17(15-9-5-2-6-10-15)13-16(22-20(18)24-23-19)12-11-14-7-3-1-4-8-14/h1-13H,(H3,21,22,23,24)/b12-11+ |
| InChIKey | CENIUFPVUFYLLU-VAWYXSNFSA-N |
| XLogP | 4.38 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |