C24H18N2 — CID 7114809
2,4-diphenyl-6-[(E)-2-phenylethenyl]pyrimidine (PubChem CID 7114809) has the molecular formula C24H18N2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2,4-diphenyl-6-[(E)-2-phenylethenyl]pyrimidine.
| Compound Name | 2,4-diphenyl-6-[(E)-2-phenylethenyl]pyrimidine |
|---|---|
| PubChem CID | 7114809 |
| Molecular Formula | C24H18N2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2,4-diphenyl-6-[(E)-2-phenylethenyl]pyrimidine |
| SMILES | C(=C/c1cc(-c2ccccc2)nc(-c2ccccc2)n1)\c1ccccc1 |
| InChI | InChI=1S/C24H18N2/c1-4-10-19(11-5-1)16-17-22-18-23(20-12-6-2-7-13-20)26-24(25-22)21-14-8-3-9-15-21/h1-18H/b17-16+ |
| InChIKey | PVIBPLCGUBSPDX-WUKNDPDISA-N |
| XLogP | 5.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |