C16H23NOSe — CID 10592048
(4R,6R)-4-methyl-2-pentyl-6-phenyl-5,6-dihydro-1,3-selenazin-4-ol (PubChem CID 10592048) has the molecular formula C16H23NOSe and a molecular weight of 324.33 g/mol. Its IUPAC name is (4R,6R)-4-methyl-2-pentyl-6-phenyl-5,6-dihydro-1,3-selenazin-4-ol.
| Compound Name | (4R,6R)-4-methyl-2-pentyl-6-phenyl-5,6-dihydro-1,3-selenazin-4-ol |
|---|---|
| PubChem CID | 10592048 |
| Molecular Formula | C16H23NOSe |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (4R,6R)-4-methyl-2-pentyl-6-phenyl-5,6-dihydro-1,3-selenazin-4-ol |
| SMILES | CCCCCC1=N[C@](C)(O)C[C@H](c2ccccc2)[Se]1 |
| InChI | InChI=1S/C16H23NOSe/c1-3-4-6-11-15-17-16(2,18)12-14(19-15)13-9-7-5-8-10-13/h5,7-10,14,18H,3-4,6,11-12H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | ZILKLUSCFYZZTF-GDBMZVCRSA-N |
| XLogP | 3.52 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|