C20H32N2O+2 — CID 7438088
2-phenyl-5,7-dipropyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-ol (PubChem CID 7438088) has the molecular formula C20H32N2O+2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 2-phenyl-5,7-dipropyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-ol.
| Compound Name | 2-phenyl-5,7-dipropyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-ol |
|---|---|
| PubChem CID | 7438088 |
| Molecular Formula | C20H32N2O+2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 2-phenyl-5,7-dipropyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-ol |
| SMILES | CCCC12C[NH+]3CC(CCC)(C[NH+](C1)C3c1ccccc1)C2O |
| InChI | InChI=1S/C20H30N2O/c1-3-10-19-12-21-14-20(11-4-2,18(19)23)15-22(13-19)17(21)16-8-6-5-7-9-16/h5-9,17-18,23H,3-4,10-15H2,1-2H3/p+2 |
| InChIKey | UFWIACGHZJEGNU-UHFFFAOYSA-P |
| XLogP | 0.43 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |