C20H23NO4 — CID 10593327
1-[4-[(dimethylamino)methyl]-2-hydroxyphenyl]-4-(4-methoxyphenyl)butane-1,3-dione (PubChem CID 10593327) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[4-[(dimethylamino)methyl]-2-hydroxyphenyl]-4-(4-methoxyphenyl)butane-1,3-dione.
| Compound Name | 1-[4-[(dimethylamino)methyl]-2-hydroxyphenyl]-4-(4-methoxyphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 10593327 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[4-[(dimethylamino)methyl]-2-hydroxyphenyl]-4-(4-methoxyphenyl)butane-1,3-dione |
| SMILES | COc1ccc(CC(=O)CC(=O)c2ccc(CN(C)C)cc2O)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-21(2)13-15-6-9-18(19(23)11-15)20(24)12-16(22)10-14-4-7-17(25-3)8-5-14/h4-9,11,23H,10,12-13H2,1-3H3 |
| InChIKey | CRKAADASNMEJSW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|