C18H36O4Si — CID 10593587
methyl 2-[(1S,2S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethyl)-2-methylcyclohexyl]acetate (PubChem CID 10593587) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethyl)-2-methylcyclohexyl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethyl)-2-methylcyclohexyl]acetate |
|---|---|
| PubChem CID | 10593587 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | methyl 2-[(1S,2S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethyl)-2-methylcyclohexyl]acetate |
| SMILES | COC(=O)C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]1(C)CCO |
| InChI | InChI=1S/C18H36O4Si/c1-17(2,3)23(6,7)22-15-9-8-10-18(4,11-12-19)14(15)13-16(20)21-5/h14-15,19H,8-13H2,1-7H3/t14-,15-,18+/m1/s1 |
| InChIKey | ORGGVZJMFHAXEG-RKVPGOIHSA-N |
| XLogP | 4.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|