C17H32O4Si — CID 10947445
3-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-6-oxocyclohexyl]propanoic acid (PubChem CID 10947445) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is 3-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-6-oxocyclohexyl]propanoic acid.
| Compound Name | 3-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-6-oxocyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 10947445 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 3-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-6-oxocyclohexyl]propanoic acid |
| SMILES | C[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCC(=O)[C@]1(C)CCC(=O)O |
| InChI | InChI=1S/C17H32O4Si/c1-12-13(21-22(6,7)16(2,3)4)8-9-14(18)17(12,5)11-10-15(19)20/h12-13H,8-11H2,1-7H3,(H,19,20)/t12-,13+,17+/m0/s1 |
| InChIKey | OTFNUSJDTOMAPM-OGHNNQOOSA-N |
| XLogP | 4.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|