C16H32O3Si — CID 141119660
2-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-methylpropanoic acid (PubChem CID 141119660) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is 2-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-methylpropanoic acid.
| Compound Name | 2-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 141119660 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 2-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)[C@@H]1CCCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-15(2,3)20(6,7)19-13-11-9-8-10-12(13)16(4,5)14(17)18/h12-13H,8-11H2,1-7H3,(H,17,18)/t12-,13-/m1/s1 |
| InChIKey | RICRDBOKPVBIMS-CHWSQXEVSA-N |
| XLogP | 4.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|