C25H44O6Si — CID 162402329
3-[2-[tert-butyl(dimethyl)silyl]oxy-5-(3-methoxy-3-oxopropyl)-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]propanoic acid (PubChem CID 162402329) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxy-5-(3-methoxy-3-oxopropyl)-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]propanoic acid.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxy-5-(3-methoxy-3-oxopropyl)-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 162402329 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxy-5-(3-methoxy-3-oxopropyl)-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]propanoic acid |
| SMILES | COC(=O)CCC1C(=O)CCC2C(C)(CCC(=O)O)C(O[Si](C)(C)C(C)(C)C)CCC12C |
| InChI | InChI=1S/C25H44O6Si/c1-23(2,3)32(7,8)31-20-13-15-24(4)17(9-12-22(29)30-6)18(26)10-11-19(24)25(20,5)16-14-21(27)28/h17,19-20H,9-16H2,1-8H3,(H,27,28) |
| InChIKey | VBADMSNDYJFLIB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|