C25H44O5Si — CID 11690995
[(1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-oxo-5-(3-oxobutyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 11690995) has the molecular formula C25H44O5Si and a molecular weight of 452.71 g/mol. Its IUPAC name is [(1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-oxo-5-(3-oxobutyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-oxo-5-(3-oxobutyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11690995 |
| Molecular Formula | C25H44O5Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | [(1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-oxo-5-(3-oxobutyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)CC[C@H]1C(=O)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]2[C@@](C)(COC(C)=O)CCC[C@]12C |
| InChI | InChI=1S/C25H44O5Si/c1-17(26)11-12-19-22(28)20(30-31(8,9)23(3,4)5)15-21-24(6,16-29-18(2)27)13-10-14-25(19,21)7/h19-21H,10-16H2,1-9H3/t19-,20+,21-,24+,25+/m0/s1 |
| InChIKey | NGKQWHYPWUFRRY-GBZFTUNMSA-N |
| XLogP | 5.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|