C25H48O3Si — CID 70276507
ethyl (5R)-5-[(1R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]hexanoate (PubChem CID 70276507) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is ethyl (5R)-5-[(1R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]hexanoate.
| Compound Name | ethyl (5R)-5-[(1R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]hexanoate |
|---|---|
| PubChem CID | 70276507 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | ethyl (5R)-5-[(1R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]hexanoate |
| SMILES | CCOC(=O)CCC[C@@H](C)[C@H]1CCC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C25H48O3Si/c1-9-27-23(26)17-10-13-19(2)20-14-11-15-21-22(16-12-18-25(20,21)6)28-29(7,8)24(3,4)5/h19-22H,9-18H2,1-8H3/t19-,20-,21+,22+,25-/m1/s1 |
| InChIKey | QDQDWSGPRCVFFZ-SHNSKLSNSA-N |
| XLogP | 7.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|