C24H46O2Si — CID 10572730
(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 10572730) has the molecular formula C24H46O2Si and a molecular weight of 394.72 g/mol. Its IUPAC name is (4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 10572730 |
| Molecular Formula | C24H46O2Si |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | CC(C)[Si](OCC[C@]1(C)[C@H](C)CC[C@]2(C)C(=O)CCC[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H46O2Si/c1-17(2)27(18(3)4,19(5)6)26-16-15-23(8)20(7)13-14-24(9)21(23)11-10-12-22(24)25/h17-21H,10-16H2,1-9H3/t20-,21+,23-,24+/m1/s1 |
| InChIKey | GPUXMBPVXXVFJO-JSRBNTPPSA-N |
| XLogP | 7.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|