C22H42O3Si2 — CID 134949282
(1R,2S,6R,7S,8R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8-tetramethyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodecan-10-one (PubChem CID 134949282) has the molecular formula C22H42O3Si2 and a molecular weight of 410.75 g/mol. Its IUPAC name is (1R,2S,6R,7S,8R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8-tetramethyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodecan-10-one.
| Compound Name | (1R,2S,6R,7S,8R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8-tetramethyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodecan-10-one |
|---|---|
| PubChem CID | 134949282 |
| Molecular Formula | C22H42O3Si2 |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | (1R,2S,6R,7S,8R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8-tetramethyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodecan-10-one |
| SMILES | C[C@@H]1CO[Si](C)(C)[C@@H]2[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@]3(C)CC[C@]12C(=O)C3 |
| InChI | InChI=1S/C22H42O3Si2/c1-16-15-25-26(6,7)19-17(10-13-24-27(8,9)20(2,3)4)21(5)11-12-22(16,19)18(23)14-21/h16-17,19H,10-15H2,1-9H3/t16-,17-,19-,21-,22-/m1/s1 |
| InChIKey | WVNOSFGJCMONME-HUEXKOPYSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|