C24H46O2Si — CID 11257930
(5R)-7-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]-5-methylheptan-2-one (PubChem CID 11257930) has the molecular formula C24H46O2Si and a molecular weight of 394.72 g/mol. Its IUPAC name is (5R)-7-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]-5-methylheptan-2-one.
| Compound Name | (5R)-7-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]-5-methylheptan-2-one |
|---|---|
| PubChem CID | 11257930 |
| Molecular Formula | C24H46O2Si |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (5R)-7-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]-5-methylheptan-2-one |
| SMILES | CC(=O)CC[C@H](C)CC[C@@]1(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C24H46O2Si/c1-17(11-12-18(2)25)13-14-24(8)16-20(19-15-21(24)23(19,6)7)26-27(9,10)22(3,4)5/h17,19-21H,11-16H2,1-10H3/t17-,19+,20-,21+,24-/m0/s1 |
| InChIKey | KUNAECLVSARDBK-ZEWLNRLRSA-N |
| XLogP | 7.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|