C23H44O2Si — CID 11234370
(4R)-6-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]-4-methylhexanal (PubChem CID 11234370) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (4R)-6-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]-4-methylhexanal.
| Compound Name | (4R)-6-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]-4-methylhexanal |
|---|---|
| PubChem CID | 11234370 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (4R)-6-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]-4-methylhexanal |
| SMILES | C[C@@H](CCC=O)CC[C@@]1(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C23H44O2Si/c1-17(11-10-14-24)12-13-23(7)16-19(18-15-20(23)22(18,5)6)25-26(8,9)21(2,3)4/h14,17-20H,10-13,15-16H2,1-9H3/t17-,18+,19-,20+,23-/m0/s1 |
| InChIKey | WFCRIVNYYOVBGI-UFWNDYSESA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|