C24H42O5Si — CID 164671695
ethyl 2-[(1S,2R,4aR,6S,8aS)-6-acetyloxy-5,5,8a-trimethyl-2'-trimethylsilyloxyspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,1'-cyclopropane]-1-yl]acetate (PubChem CID 164671695) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is ethyl 2-[(1S,2R,4aR,6S,8aS)-6-acetyloxy-5,5,8a-trimethyl-2'-trimethylsilyloxyspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,1'-cyclopropane]-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,2R,4aR,6S,8aS)-6-acetyloxy-5,5,8a-trimethyl-2'-trimethylsilyloxyspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,1'-cyclopropane]-1-yl]acetate |
|---|---|
| PubChem CID | 164671695 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | ethyl 2-[(1S,2R,4aR,6S,8aS)-6-acetyloxy-5,5,8a-trimethyl-2'-trimethylsilyloxyspiro[3,4,4a,6,7,8-hexahydro-1H-naphthalene-2,1'-cyclopropane]-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@]2(CC[C@H]3C(C)(C)[C@@H](OC(C)=O)CC[C@]13C)CC2O[Si](C)(C)C |
| InChI | InChI=1S/C24H42O5Si/c1-9-27-21(26)14-18-23(5)12-11-19(28-16(2)25)22(3,4)17(23)10-13-24(18)15-20(24)29-30(6,7)8/h17-20H,9-15H2,1-8H3/t17-,18-,19-,20?,23-,24+/m0/s1 |
| InChIKey | NGSKXDVEDSFZIC-WLOZVARASA-N |
| XLogP | 5.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|