C16H28O4Si — CID 134922819
[(2R,4aS,5R,8aR)-4a-formyl-5-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl] acetate (PubChem CID 134922819) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is [(2R,4aS,5R,8aR)-4a-formyl-5-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2R,4aS,5R,8aR)-4a-formyl-5-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 134922819 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [(2R,4aS,5R,8aR)-4a-formyl-5-trimethylsilyloxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C=O)[C@H](CCC[C@H]2O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C16H28O4Si/c1-12(18)19-14-8-9-16(11-17)13(10-14)6-5-7-15(16)20-21(2,3)4/h11,13-15H,5-10H2,1-4H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | YQFFFOXPQXTVJZ-FPCVCCKLSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|