C19H34O4Si — CID 71474625
methyl (1R,4aR,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-2-oxo-1,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 71474625) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is methyl (1R,4aR,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-2-oxo-1,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1R,4aR,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-2-oxo-1,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 71474625 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl (1R,4aR,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-2-oxo-1,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)CC[C@]2(C)[C@@H]1CCC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O4Si/c1-18(2,3)24(6,7)23-15-10-8-9-13-16(17(21)22-5)14(20)11-12-19(13,15)4/h13,15-16H,8-12H2,1-7H3/t13-,15-,16-,19-/m1/s1 |
| InChIKey | PYFXRSJOBQCNBB-NVQRDWNXSA-N |
| XLogP | 4.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|