C24H42O5Si — CID 11524958
methyl (1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-oxo-5-(3-oxobutyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 11524958) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is methyl (1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-oxo-5-(3-oxobutyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-oxo-5-(3-oxobutyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11524958 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | methyl (1S,4aS,5R,7R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-6-oxo-5-(3-oxobutyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@@]2(C)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@@H]2CCC(C)=O |
| InChI | InChI=1S/C24H42O5Si/c1-16(25)11-12-17-20(26)18(29-30(8,9)22(2,3)4)15-19-23(17,5)13-10-14-24(19,6)21(27)28-7/h17-19H,10-15H2,1-9H3/t17-,18+,19+,23+,24-/m0/s1 |
| InChIKey | MWRWIPYXGVJEAQ-YECSIJRFSA-N |
| XLogP | 5.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|