C17H21NO5S — CID 10594085
8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-5,7-dimethoxy-2-sulfanylchromen-4-one (PubChem CID 10594085) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-5,7-dimethoxy-2-sulfanylchromen-4-one.
| Compound Name | 8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-5,7-dimethoxy-2-sulfanylchromen-4-one |
|---|---|
| PubChem CID | 10594085 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-5,7-dimethoxy-2-sulfanylchromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(S)oc2c1[C@H]1CCN(C)C[C@H]1O |
| InChI | InChI=1S/C17H21NO5S/c1-18-5-4-9(11(20)8-18)15-12(21-2)7-13(22-3)16-10(19)6-14(24)23-17(15)16/h6-7,9,11,20,24H,4-5,8H2,1-3H3/t9-,11+/m0/s1 |
| InChIKey | ZZHCHNXMGPVVRR-GXSJLCMTSA-N |
| XLogP | 1.88 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|