C16H20N2O4 — CID 144595649
2-amino-5,7-dimethoxy-8-(1-methylpyrrolidin-3-yl)chromen-4-one (PubChem CID 144595649) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-amino-5,7-dimethoxy-8-(1-methylpyrrolidin-3-yl)chromen-4-one.
| Compound Name | 2-amino-5,7-dimethoxy-8-(1-methylpyrrolidin-3-yl)chromen-4-one |
|---|---|
| PubChem CID | 144595649 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-amino-5,7-dimethoxy-8-(1-methylpyrrolidin-3-yl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(N)oc2c1C1CCN(C)C1 |
| InChI | InChI=1S/C16H20N2O4/c1-18-5-4-9(8-18)14-11(20-2)7-12(21-3)15-10(19)6-13(17)22-16(14)15/h6-7,9H,4-5,8,17H2,1-3H3 |
| InChIKey | SRQSYVQUSAUXSF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |