C7H10F3NO2 — CID 105942342
(E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid (PubChem CID 105942342) has the molecular formula C7H10F3NO2 and a molecular weight of 197.15 g/mol. Its IUPAC name is (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid.
| Compound Name | (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 105942342 |
| Molecular Formula | C7H10F3NO2 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid |
| SMILES | CC(CC(F)(F)F)N/C=C/C(=O)O |
| InChI | InChI=1S/C7H10F3NO2/c1-5(4-7(8,9)10)11-3-2-6(12)13/h2-3,5,11H,4H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | ILJMIKVHSLFVND-NSCUHMNNSA-N |
| XLogP | 2.50 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | 200 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|