(E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid

C7H10F3NO2 — CID 105942342

IUPAC(E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid
SMILESCC(CC(F)(F)F)N/C=C/C(=O)O
InChIInChI=1S/C7H10F3NO2/c1-5(4-7(8,9)10)11-3-2-6(12)13/h2-3,5,11H,4H2,1H3,(H,12,13)/b3-2+
InChIKeyILJMIKVHSLFVND-NSCUHMNNSA-N
MW197.15 g/mol
LogP2.50
Rot. Bonds4

About (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid

(E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid (PubChem CID 105942342) has the molecular formula C7H10F3NO2 and a molecular weight of 197.15 g/mol. Its IUPAC name is (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid
PubChem CID105942342
Molecular FormulaC7H10F3NO2
Molecular Weight197.15 g/mol
Exact Mass197.07
IUPAC Name(E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid
SMILESCC(CC(F)(F)F)N/C=C/C(=O)O
InChIInChI=1S/C7H10F3NO2/c1-5(4-7(8,9)10)11-3-2-6(12)13/h2-3,5,11H,4H2,1H3,(H,12,13)/b3-2+
InChIKeyILJMIKVHSLFVND-NSCUHMNNSA-N
XLogP2.50
TPSA49.30 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms13
Complexity200

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.15
LogP ≤ 52.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid?
The IUPAC name of (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid (CID 105942342) is (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid?
The canonical SMILES for (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid is CC(CC(F)(F)F)N/C=C/C(=O)O.
What is the InChIKey of (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid?
The InChIKey is ILJMIKVHSLFVND-NSCUHMNNSA-N. The full InChI is InChI=1S/C7H10F3NO2/c1-5(4-7(8,9)10)11-3-2-6(12)13/h2-3,5,11H,4H2,1H3,(H,12,13)/b3-2+.
What are the key properties of (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid?
(E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid has a molecular weight of 197.15 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4,4,4-trifluorobutan-2-ylamino)prop-2-enoic acid is sourced from PubChem (CID 105942342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).