C6H7F4NO2 — CID 106294360
(E)-3-(2,2,3,3-tetrafluoropropylamino)prop-2-enoic acid (PubChem CID 106294360) has the molecular formula C6H7F4NO2 and a molecular weight of 201.12 g/mol. Its IUPAC name is (E)-3-(2,2,3,3-tetrafluoropropylamino)prop-2-enoic acid.
| Compound Name | (E)-3-(2,2,3,3-tetrafluoropropylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 106294360 |
| Molecular Formula | C6H7F4NO2 |
| Molecular Weight | 201.12 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (E)-3-(2,2,3,3-tetrafluoropropylamino)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/NCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H7F4NO2/c7-5(8)6(9,10)3-11-2-1-4(12)13/h1-2,5,11H,3H2,(H,12,13)/b2-1+ |
| InChIKey | VQEFOWRQMFRCLG-OWOJBTEDSA-N |
| XLogP | 1.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.12 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|