(E)-3-(2,2-difluoroethylamino)prop-2-enoic acid

C5H7F2NO2 — CID 103260440

IUPAC(E)-3-(2,2-difluoroethylamino)prop-2-enoic acid
SMILESO=C(O)/C=C/NCC(F)F
InChIInChI=1S/C5H7F2NO2/c6-4(7)3-8-2-1-5(9)10/h1-2,4,8H,3H2,(H,9,10)/b2-1+
InChIKeyHRJOAXMSLGKQDJ-OWOJBTEDSA-N
MW151.11 g/mol
LogP0.44
Rot. Bonds4

About (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid

(E)-3-(2,2-difluoroethylamino)prop-2-enoic acid (PubChem CID 103260440) has the molecular formula C5H7F2NO2 and a molecular weight of 151.11 g/mol. Its IUPAC name is (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(2,2-difluoroethylamino)prop-2-enoic acid
PubChem CID103260440
Molecular FormulaC5H7F2NO2
Molecular Weight151.11 g/mol
Exact Mass151.04
IUPAC Name(E)-3-(2,2-difluoroethylamino)prop-2-enoic acid
SMILESO=C(O)/C=C/NCC(F)F
InChIInChI=1S/C5H7F2NO2/c6-4(7)3-8-2-1-5(9)10/h1-2,4,8H,3H2,(H,9,10)/b2-1+
InChIKeyHRJOAXMSLGKQDJ-OWOJBTEDSA-N
XLogP0.44
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.11
LogP ≤ 50.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid?
The IUPAC name of (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid (CID 103260440) is (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid?
The canonical SMILES for (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid is O=C(O)/C=C/NCC(F)F.
What is the InChIKey of (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid?
The InChIKey is HRJOAXMSLGKQDJ-OWOJBTEDSA-N. The full InChI is InChI=1S/C5H7F2NO2/c6-4(7)3-8-2-1-5(9)10/h1-2,4,8H,3H2,(H,9,10)/b2-1+.
What are the key properties of (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid?
(E)-3-(2,2-difluoroethylamino)prop-2-enoic acid has a molecular weight of 151.11 g/mol, XLogP of 0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,2-difluoroethylamino)prop-2-enoic acid is sourced from PubChem (CID 103260440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).