C20H24O4Si — CID 10594452
trimethylsilyl (E)-2,3-bis(2-methoxyphenyl)prop-2-enoate (PubChem CID 10594452) has the molecular formula C20H24O4Si and a molecular weight of 356.49 g/mol. Its IUPAC name is trimethylsilyl (E)-2,3-bis(2-methoxyphenyl)prop-2-enoate.
| Compound Name | trimethylsilyl (E)-2,3-bis(2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 10594452 |
| Molecular Formula | C20H24O4Si |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | trimethylsilyl (E)-2,3-bis(2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccccc1/C=C(/C(=O)O[Si](C)(C)C)c1ccccc1OC |
| InChI | InChI=1S/C20H24O4Si/c1-22-18-12-8-6-10-15(18)14-17(20(21)24-25(3,4)5)16-11-7-9-13-19(16)23-2/h6-14H,1-5H3/b17-14+ |
| InChIKey | QTLNWLAVSFCMAN-SAPNQHFASA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|