C17H28O5Si2 — CID 5372919
trimethylsilyl (E)-3-(2,3-dimethoxyphenyl)-2-trimethylsilyloxyprop-2-enoate (PubChem CID 5372919) has the molecular formula C17H28O5Si2 and a molecular weight of 368.58 g/mol. Its IUPAC name is trimethylsilyl (E)-3-(2,3-dimethoxyphenyl)-2-trimethylsilyloxyprop-2-enoate.
| Compound Name | trimethylsilyl (E)-3-(2,3-dimethoxyphenyl)-2-trimethylsilyloxyprop-2-enoate |
|---|---|
| PubChem CID | 5372919 |
| Molecular Formula | C17H28O5Si2 |
| Molecular Weight | 368.58 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | trimethylsilyl (E)-3-(2,3-dimethoxyphenyl)-2-trimethylsilyloxyprop-2-enoate |
| SMILES | COc1cccc(/C=C(/O[Si](C)(C)C)C(=O)O[Si](C)(C)C)c1OC |
| InChI | InChI=1S/C17H28O5Si2/c1-19-14-11-9-10-13(16(14)20-2)12-15(21-23(3,4)5)17(18)22-24(6,7)8/h9-12H,1-8H3/b15-12+ |
| InChIKey | NQFALXABUYVRDQ-NTCAYCPXSA-N |
| XLogP | 4.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|