C18H20FNO6 — CID 10594988
ethyl 2-[[1-(2-ethoxy-2-oxoethyl)-5-fluoro-1-methyl-3-oxo-2H-inden-2-yl]amino]-2-oxoacetate (PubChem CID 10594988) has the molecular formula C18H20FNO6 and a molecular weight of 365.36 g/mol. Its IUPAC name is ethyl 2-[[1-(2-ethoxy-2-oxoethyl)-5-fluoro-1-methyl-3-oxo-2H-inden-2-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[1-(2-ethoxy-2-oxoethyl)-5-fluoro-1-methyl-3-oxo-2H-inden-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 10594988 |
| Molecular Formula | C18H20FNO6 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | ethyl 2-[[1-(2-ethoxy-2-oxoethyl)-5-fluoro-1-methyl-3-oxo-2H-inden-2-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)CC1(C)c2ccc(F)cc2C(=O)C1NC(=O)C(=O)OCC |
| InChI | InChI=1S/C18H20FNO6/c1-4-25-13(21)9-18(3)12-7-6-10(19)8-11(12)14(22)15(18)20-16(23)17(24)26-5-2/h6-8,15H,4-5,9H2,1-3H3,(H,20,23) |
| InChIKey | CHLLDMMCVMDMSR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|