C16H15FN2O4 — CID 10781790
ethyl 2-(6-fluoro-9-methyl-2,3-dioxo-1,4-dihydroindeno[2,3-b]pyrazin-9-yl)acetate (PubChem CID 10781790) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is ethyl 2-(6-fluoro-9-methyl-2,3-dioxo-1,4-dihydroindeno[2,3-b]pyrazin-9-yl)acetate.
| Compound Name | ethyl 2-(6-fluoro-9-methyl-2,3-dioxo-1,4-dihydroindeno[2,3-b]pyrazin-9-yl)acetate |
|---|---|
| PubChem CID | 10781790 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | ethyl 2-(6-fluoro-9-methyl-2,3-dioxo-1,4-dihydroindeno[2,3-b]pyrazin-9-yl)acetate |
| SMILES | CCOC(=O)CC1(C)c2ccc(F)cc2-c2[nH]c(=O)c(=O)[nH]c21 |
| InChI | InChI=1S/C16H15FN2O4/c1-3-23-11(20)7-16(2)10-5-4-8(17)6-9(10)12-13(16)19-15(22)14(21)18-12/h4-6H,3,7H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | GOSZHUFLYFIAFS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|