C22H32N2O3 — CID 10595468
tert-butyl N-[(1S)-1-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]prop-2-enyl]carbamate (PubChem CID 10595468) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 10595468 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]prop-2-enyl]carbamate |
| SMILES | C=C[C@H](NC(=O)OC(C)(C)C)[C@@H]1C[C@@]1(C(=O)N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O3/c1-7-18(23-20(26)27-21(4,5)6)17-15-22(17,16-13-11-10-12-14-16)19(25)24(8-2)9-3/h7,10-14,17-18H,1,8-9,15H2,2-6H3,(H,23,26)/t17-,18-,22+/m0/s1 |
| InChIKey | IEXYGNAWFJDIJN-NPPFBWRTSA-N |
| XLogP | 3.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|