C25H46O4Si — CID 10599168
(2S)-2-[(2S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]-2H-furan-5-one (PubChem CID 10599168) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is (2S)-2-[(2S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]-2H-furan-5-one.
| Compound Name | (2S)-2-[(2S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 10599168 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | (2S)-2-[(2S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]-2H-furan-5-one |
| SMILES | CCCCCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)C1CC[C@@H]([C@@H]2C=CC(=O)O2)O1 |
| InChI | InChI=1S/C25H46O4Si/c1-7-8-9-10-11-12-13-14-15-23(29-30(5,6)25(2,3)4)22-17-16-20(27-22)21-18-19-24(26)28-21/h18-23H,7-17H2,1-6H3/t20-,21-,22?,23-/m0/s1 |
| InChIKey | WFMZFXXFNOYSJX-WUTAMTCCSA-N |
| XLogP | 6.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|