C13H19Br2N3O2S — CID 106002010
3-(aminomethyl)-N-(2,6-dibromo-4-methylphenyl)piperidine-1-sulfonamide (PubChem CID 106002010) has the molecular formula C13H19Br2N3O2S and a molecular weight of 441.19 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2,6-dibromo-4-methylphenyl)piperidine-1-sulfonamide.
| Compound Name | 3-(aminomethyl)-N-(2,6-dibromo-4-methylphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106002010 |
| Molecular Formula | C13H19Br2N3O2S |
| Molecular Weight | 441.19 g/mol |
| Exact Mass | 438.96 |
| IUPAC Name | 3-(aminomethyl)-N-(2,6-dibromo-4-methylphenyl)piperidine-1-sulfonamide |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)N2CCCC(CN)C2)c(Br)c1 |
| InChI | InChI=1S/C13H19Br2N3O2S/c1-9-5-11(14)13(12(15)6-9)17-21(19,20)18-4-2-3-10(7-16)8-18/h5-6,10,17H,2-4,7-8,16H2,1H3 |
| InChIKey | ZARHOBCJBQKZIL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |