C12H17ClFN3O2S — CID 106028995
3-(aminomethyl)-N-(2-chloro-4-fluorophenyl)piperidine-1-sulfonamide (PubChem CID 106028995) has the molecular formula C12H17ClFN3O2S and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-chloro-4-fluorophenyl)piperidine-1-sulfonamide.
| Compound Name | 3-(aminomethyl)-N-(2-chloro-4-fluorophenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106028995 |
| Molecular Formula | C12H17ClFN3O2S |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3-(aminomethyl)-N-(2-chloro-4-fluorophenyl)piperidine-1-sulfonamide |
| SMILES | NCC1CCCN(S(=O)(=O)Nc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C12H17ClFN3O2S/c13-11-6-10(14)3-4-12(11)16-20(18,19)17-5-1-2-9(7-15)8-17/h3-4,6,9,16H,1-2,5,7-8,15H2 |
| InChIKey | JIPGSROQNMNLHQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |