C28H34O6 — CID 10600292
bis[(Z)-hex-2-enyl] 2,3-dihydroxy-2,3-diphenylbutanedioate (PubChem CID 10600292) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is bis[(Z)-hex-2-enyl] 2,3-dihydroxy-2,3-diphenylbutanedioate.
| Compound Name | bis[(Z)-hex-2-enyl] 2,3-dihydroxy-2,3-diphenylbutanedioate |
|---|---|
| PubChem CID | 10600292 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | bis[(Z)-hex-2-enyl] 2,3-dihydroxy-2,3-diphenylbutanedioate |
| SMILES | CCC/C=C\COC(=O)C(O)(c1ccccc1)C(O)(C(=O)OC/C=C\CCC)c1ccccc1 |
| InChI | InChI=1S/C28H34O6/c1-3-5-7-15-21-33-25(29)27(31,23-17-11-9-12-18-23)28(32,24-19-13-10-14-20-24)26(30)34-22-16-8-6-4-2/h7-20,31-32H,3-6,21-22H2,1-2H3/b15-7-,16-8- |
| InChIKey | GHBQCBBLJUDZDG-DUGOVBPYSA-N |
| XLogP | 4.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|