C23H47NO5Si2 — CID 10600564
tert-butyl (2R)-2-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 10600564) has the molecular formula C23H47NO5Si2 and a molecular weight of 473.80 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10600564 |
| Molecular Formula | C23H47NO5Si2 |
| Molecular Weight | 473.80 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | tert-butyl (2R)-2-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H47NO5Si2/c1-21(2,3)28-20(26)24-17(14-15-19(24)25)18(29-31(12,13)23(7,8)9)16-27-30(10,11)22(4,5)6/h17-18H,14-16H2,1-13H3/t17-,18-/m1/s1 |
| InChIKey | GYLSWKGCRUKKIO-QZTJIDSGSA-N |
| XLogP | 6.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.80 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|