C16H30FNO4Si — CID 101170046
tert-butyl (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-oxopyrrolidine-1-carboxylate (PubChem CID 101170046) has the molecular formula C16H30FNO4Si and a molecular weight of 347.50 g/mol. Its IUPAC name is tert-butyl (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101170046 |
| Molecular Formula | C16H30FNO4Si |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | tert-butyl (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H](F)C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30FNO4Si/c1-15(2,3)22-14(20)18-11(9-12(17)13(18)19)10-21-23(7,8)16(4,5)6/h11-12H,9-10H2,1-8H3/t11-,12+/m0/s1 |
| InChIKey | FKYQCOHYCOUTQW-NWDGAFQWSA-N |
| XLogP | 3.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|