C16H29NO5Si — CID 6430000
2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) 5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 6430000) has the molecular formula C16H29NO5Si and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) 5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) 5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6430000 |
| Molecular Formula | C16H29NO5Si |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) 5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)N1C(=O)CCC1C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29NO5Si/c1-11(2)10-21-15(20)17-12(8-9-13(17)18)14(19)22-23(6,7)16(3,4)5/h11-12H,8-10H2,1-7H3 |
| InChIKey | LJMQDOAOBLEGDM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|