C20H37NO6Si — CID 25138495
ditert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 25138495) has the molecular formula C20H37NO6Si and a molecular weight of 415.60 g/mol. Its IUPAC name is ditert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 25138495 |
| Molecular Formula | C20H37NO6Si |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | ditert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO6Si/c1-18(2,3)25-16(23)13-12-14(27-28(10,11)20(7,8)9)15(22)21(13)17(24)26-19(4,5)6/h13-14H,12H2,1-11H3/t13-,14+/m0/s1 |
| InChIKey | BXZVMOPJQUPVQL-UONOGXRCSA-N |
| XLogP | 4.25 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|