C17H33NO8Si — CID 134946722
1-O-tert-butyl 2-O-methyl (2S)-4-(3-trimethoxysilylpropoxy)pyrrolidine-1,2-dicarboxylate (PubChem CID 134946722) has the molecular formula C17H33NO8Si and a molecular weight of 407.54 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-4-(3-trimethoxysilylpropoxy)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-4-(3-trimethoxysilylpropoxy)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134946722 |
| Molecular Formula | C17H33NO8Si |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-4-(3-trimethoxysilylpropoxy)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC(OCCC[Si](OC)(OC)OC)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H33NO8Si/c1-17(2,3)26-16(20)18-12-13(11-14(18)15(19)21-4)25-9-8-10-27(22-5,23-6)24-7/h13-14H,8-12H2,1-7H3/t13?,14-/m0/s1 |
| InChIKey | CYYXPGAUNKWFIC-KZUDCZAMSA-N |
| XLogP | 1.82 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|