C20H39NO5Si — CID 102027970
ditert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate (PubChem CID 102027970) has the molecular formula C20H39NO5Si and a molecular weight of 401.62 g/mol. Its IUPAC name is ditert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102027970 |
| Molecular Formula | C20H39NO5Si |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | ditert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39NO5Si/c1-18(2,3)24-16(22)15-12-14(26-27(10,11)20(7,8)9)13-21(15)17(23)25-19(4,5)6/h14-15H,12-13H2,1-11H3/t14-,15+/m1/s1 |
| InChIKey | WSMWHEYOJCXTFD-CABCVRRESA-N |
| XLogP | 4.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|