C16H29NO5Si — CID 135019366
tert-butyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dioxopyrrolidine-1-carboxylate (PubChem CID 135019366) has the molecular formula C16H29NO5Si and a molecular weight of 343.50 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dioxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dioxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135019366 |
| Molecular Formula | C16H29NO5Si |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | tert-butyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dioxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC(=O)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29NO5Si/c1-15(2,3)22-14(20)17-11(12(18)9-13(17)19)10-21-23(7,8)16(4,5)6/h11H,9-10H2,1-8H3/t11-/m1/s1 |
| InChIKey | XYPAFXVBNVVNDQ-LLVKDONJSA-N |
| XLogP | 3.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|