C16H31NO4Si — CID 10568516
tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dideuterio-5-oxopyrrolidine-1-carboxylate (PubChem CID 10568516) has the molecular formula C16H31NO4Si and a molecular weight of 331.53 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dideuterio-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dideuterio-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10568516 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dideuterio-5-oxopyrrolidine-1-carboxylate |
| SMILES | [2H]C1C(=O)N(C(=O)OC(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)C1[2H] |
| InChI | InChI=1S/C16H31NO4Si/c1-15(2,3)21-14(19)17-12(9-10-13(17)18)11-20-22(7,8)16(4,5)6/h12H,9-11H2,1-8H3/t12-/m0/s1/i9D,10D/t9?,10?,12- |
| InChIKey | BIVAQLMYVMOBJZ-BLTWAICHSA-N |
| XLogP | 3.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|