C15H29NO4Si — CID 135018918
tert-butyl (5S)-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate (PubChem CID 135018918) has the molecular formula C15H29NO4Si and a molecular weight of 315.49 g/mol. Its IUPAC name is tert-butyl (5S)-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135018918 |
| Molecular Formula | C15H29NO4Si |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | tert-butyl (5S)-2-oxo-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@H]1C(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H29NO4Si/c1-14(2,3)19-13(18)16-11(9-10-12(16)17)15(4,5)20-21(6,7)8/h11H,9-10H2,1-8H3/t11-/m0/s1 |
| InChIKey | QSEGFKJGTVTAPL-NSHDSACASA-N |
| XLogP | 3.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|