C10H12N2S2 — CID 106005743
3-[(5-ethylthiophen-2-yl)methyl]-1H-imidazole-2-thione (PubChem CID 106005743) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 3-[(5-ethylthiophen-2-yl)methyl]-1H-imidazole-2-thione.
| Compound Name | 3-[(5-ethylthiophen-2-yl)methyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 106005743 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-[(5-ethylthiophen-2-yl)methyl]-1H-imidazole-2-thione |
| SMILES | CCc1ccc(Cn2cc[nH]c2=S)s1 |
| InChI | InChI=1S/C10H12N2S2/c1-2-8-3-4-9(14-8)7-12-6-5-11-10(12)13/h3-6H,2,7H2,1H3,(H,11,13) |
| InChIKey | ATHSRWPFRCVIAC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|